| Name | Propargyl acrylate |
| Synonyms | PROPARGYL ACRYLATE Propargyl acrylate TIMTEC-BB SBB008981 2-propynyl acrylate 2-propyn-1-yl propenoate ACRYLIC ACID PROPARGYL ESTER prop-2-yn-1-yl prop-2-enoate 2-propenoicacid,2-propynylester Acrylic acid propargyl ester~2-Propyn-1-yl propenoate |
| CAS | 10477-47-1 |
| EINECS | 233-975-8 |
| InChI | InChI=1/C6H6O2/c1-3-5-8-6(7)4-2/h1,4H,2,5H2 |
| Molecular Formula | C6H6O2 |
| Molar Mass | 110.11 |
| Density | 0.997 g/mL at 25 °C (lit.) |
| Boling Point | 142-143 °C (lit.) |
| Flash Point | 110°F |
| Water Solubility | Not miscible or difficult to mix with water. |
| Vapor Presure | 10.3mmHg at 25°C |
| BRN | 1902961 |
| Storage Condition | 2-8℃ |
| Refractive Index | n20/D 1.447(lit.) |
| MDL | MFCD00078451 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R10 - Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29159000 |
| Hazard Class | 6.1 |
| Packing Group | II |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |